C18H35N3O — CID 111755990
1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-methyl-3-(6-methylheptan-2-yl)guanidine (PubChem CID 111755990) has the molecular formula C18H35N3O and a molecular weight of 309.50 g/mol. Its IUPAC name is 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-methyl-3-(6-methylheptan-2-yl)guanidine.
| Compound Name | 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-methyl-3-(6-methylheptan-2-yl)guanidine |
|---|---|
| PubChem CID | 111755990 |
| Molecular Formula | C18H35N3O |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.28 |
| IUPAC Name | 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-methyl-3-(6-methylheptan-2-yl)guanidine |
| SMILES | C/N=C(\NC(C)CCCC(C)C)NC1C2CCOC2C1(C)C |
| InChI | InChI=1S/C18H35N3O/c1-12(2)8-7-9-13(3)20-17(19-6)21-15-14-10-11-22-16(14)18(15,4)5/h12-16H,7-11H2,1-6H3,(H2,19,20,21) |
| InChIKey | VVEOWTWYYPXDBU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|