C19H39IN4O2 — CID 111757003
1-ethyl-3-(3-methoxy-2,2,3-trimethylcyclobutyl)-2-(2-methyl-2-morpholin-4-ylpropyl)guanidine;hydroiodide (PubChem CID 111757003) has the molecular formula C19H39IN4O2 and a molecular weight of 482.45 g/mol. Its IUPAC name is 1-ethyl-3-(3-methoxy-2,2,3-trimethylcyclobutyl)-2-(2-methyl-2-morpholin-4-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(3-methoxy-2,2,3-trimethylcyclobutyl)-2-(2-methyl-2-morpholin-4-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111757003 |
| Molecular Formula | C19H39IN4O2 |
| Molecular Weight | 482.45 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | 1-ethyl-3-(3-methoxy-2,2,3-trimethylcyclobutyl)-2-(2-methyl-2-morpholin-4-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)N1CCOCC1)NC1CC(C)(OC)C1(C)C.I |
| InChI | InChI=1S/C19H38N4O2.HI/c1-8-20-16(22-15-13-19(6,24-7)18(15,4)5)21-14-17(2,3)23-9-11-25-12-10-23;/h15H,8-14H2,1-7H3,(H2,20,21,22);1H |
| InChIKey | KQXOBGOIWTZVCV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|