C17H24O6S — CID 11175721
[(2S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxypent-4-enyl] 4-methylbenzenesulfonate (PubChem CID 11175721) has the molecular formula C17H24O6S and a molecular weight of 356.44 g/mol. Its IUPAC name is [(2S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxypent-4-enyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxypent-4-enyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11175721 |
| Molecular Formula | C17H24O6S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | [(2S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxypent-4-enyl] 4-methylbenzenesulfonate |
| SMILES | C=CC[C@](O)(COS(=O)(=O)c1ccc(C)cc1)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C17H24O6S/c1-5-10-17(18,15-11-21-16(3,4)23-15)12-22-24(19,20)14-8-6-13(2)7-9-14/h5-9,15,18H,1,10-12H2,2-4H3/t15-,17-/m0/s1 |
| InChIKey | XEJNJFAZICOFFN-RDJZCZTQSA-N |
| XLogP | 2.16 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|