C18H40O3Si2 — CID 11175848
[tert-butyl(dimethyl)silyl] (2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methylpentanoate (PubChem CID 11175848) has the molecular formula C18H40O3Si2 and a molecular weight of 360.69 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] (2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methylpentanoate.
| Compound Name | [tert-butyl(dimethyl)silyl] (2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methylpentanoate |
|---|---|
| PubChem CID | 11175848 |
| Molecular Formula | C18H40O3Si2 |
| Molecular Weight | 360.69 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] (2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methylpentanoate |
| SMILES | CC(C)C[C@H](O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H40O3Si2/c1-14(2)13-15(20-22(9,10)17(3,4)5)16(19)21-23(11,12)18(6,7)8/h14-15H,13H2,1-12H3/t15-/m0/s1 |
| InChIKey | MUXPVGBUUPXKBR-HNNXBMFYSA-N |
| XLogP | 5.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.69 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|