C18H40O3Si2 — CID 553036
[tert-butyl(dimethyl)silyl] 2-[tert-butyl(dimethyl)silyl]oxyhexanoate (PubChem CID 553036) has the molecular formula C18H40O3Si2 and a molecular weight of 360.69 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 2-[tert-butyl(dimethyl)silyl]oxyhexanoate.
| Compound Name | [tert-butyl(dimethyl)silyl] 2-[tert-butyl(dimethyl)silyl]oxyhexanoate |
|---|---|
| PubChem CID | 553036 |
| Molecular Formula | C18H40O3Si2 |
| Molecular Weight | 360.69 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 2-[tert-butyl(dimethyl)silyl]oxyhexanoate |
| SMILES | CCCCC(O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H40O3Si2/c1-12-13-14-15(20-22(8,9)17(2,3)4)16(19)21-23(10,11)18(5,6)7/h15H,12-14H2,1-11H3 |
| InChIKey | RPWPVVLWXNCLQJ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.69 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|