C19H37N5O — CID 111759745
1-[5-(diethylamino)pentan-2-yl]-2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-3-ethylguanidine (PubChem CID 111759745) has the molecular formula C19H37N5O and a molecular weight of 351.54 g/mol. Its IUPAC name is 1-[5-(diethylamino)pentan-2-yl]-2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-3-ethylguanidine.
| Compound Name | 1-[5-(diethylamino)pentan-2-yl]-2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111759745 |
| Molecular Formula | C19H37N5O |
| Molecular Weight | 351.54 g/mol |
| Exact Mass | 351.30 |
| IUPAC Name | 1-[5-(diethylamino)pentan-2-yl]-2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\CCc1c(C)noc1C)NC(C)CCCN(CC)CC |
| InChI | InChI=1S/C19H37N5O/c1-7-20-19(21-13-12-18-16(5)23-25-17(18)6)22-15(4)11-10-14-24(8-2)9-3/h15H,7-14H2,1-6H3,(H2,20,21,22) |
| InChIKey | JUQWFWNXXIOJTN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.54 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|