C18H20ClIN6O — CID 111760722
1-[(4-chlorophenyl)methyl]-2-methyl-3-[2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111760722) has the molecular formula C18H20ClIN6O and a molecular weight of 498.76 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-2-methyl-3-[2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[(4-chlorophenyl)methyl]-2-methyl-3-[2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111760722 |
| Molecular Formula | C18H20ClIN6O |
| Molecular Weight | 498.76 g/mol |
| Exact Mass | 498.04 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-2-methyl-3-[2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1noc(-c2ccccn2)n1)NCc1ccc(Cl)cc1.I |
| InChI | InChI=1S/C18H19ClN6O.HI/c1-20-18(23-12-13-5-7-14(19)8-6-13)22-11-9-16-24-17(26-25-16)15-4-2-3-10-21-15;/h2-8,10H,9,11-12H2,1H3,(H2,20,22,23);1H |
| InChIKey | HQPWBRBHVHLJLZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 88.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.76 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|