C19H23IN6O2 — CID 111764238
1-[(3-methoxyphenyl)methyl]-2-methyl-3-[2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111764238) has the molecular formula C19H23IN6O2 and a molecular weight of 494.34 g/mol. Its IUPAC name is 1-[(3-methoxyphenyl)methyl]-2-methyl-3-[2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[(3-methoxyphenyl)methyl]-2-methyl-3-[2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111764238 |
| Molecular Formula | C19H23IN6O2 |
| Molecular Weight | 494.34 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | 1-[(3-methoxyphenyl)methyl]-2-methyl-3-[2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1noc(-c2ccccn2)n1)NCc1cccc(OC)c1.I |
| InChI | InChI=1S/C19H22N6O2.HI/c1-20-19(23-13-14-6-5-7-15(12-14)26-2)22-11-9-17-24-18(27-25-17)16-8-3-4-10-21-16;/h3-8,10,12H,9,11,13H2,1-2H3,(H2,20,22,23);1H |
| InChIKey | VGIQHWJUXRLXMO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|