C24H35NO2 — CID 11176148
tert-butyl (E,3S)-3-[[(1S)-1-phenylethyl]-prop-2-enylamino]-2-prop-2-enylhex-4-enoate (PubChem CID 11176148) has the molecular formula C24H35NO2 and a molecular weight of 369.55 g/mol. Its IUPAC name is tert-butyl (E,3S)-3-[[(1S)-1-phenylethyl]-prop-2-enylamino]-2-prop-2-enylhex-4-enoate.
| Compound Name | tert-butyl (E,3S)-3-[[(1S)-1-phenylethyl]-prop-2-enylamino]-2-prop-2-enylhex-4-enoate |
|---|---|
| PubChem CID | 11176148 |
| Molecular Formula | C24H35NO2 |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.27 |
| IUPAC Name | tert-butyl (E,3S)-3-[[(1S)-1-phenylethyl]-prop-2-enylamino]-2-prop-2-enylhex-4-enoate |
| SMILES | C=CCC(C(=O)OC(C)(C)C)[C@H](/C=C/C)N(CC=C)[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C24H35NO2/c1-8-14-21(23(26)27-24(5,6)7)22(15-9-2)25(18-10-3)19(4)20-16-12-11-13-17-20/h8-13,15-17,19,21-22H,1,3,14,18H2,2,4-7H3/b15-9+/t19-,21?,22-/m0/s1 |
| InChIKey | ZLDOVFKBAFLGDI-IWEUAVHBSA-N |
| XLogP | 5.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|