C23H34ClN5O — CID 111762597
1-[2-(4-chlorophenyl)ethyl]-2-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-3-ethylguanidine (PubChem CID 111762597) has the molecular formula C23H34ClN5O and a molecular weight of 432.01 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)ethyl]-2-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-3-ethylguanidine.
| Compound Name | 1-[2-(4-chlorophenyl)ethyl]-2-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111762597 |
| Molecular Formula | C23H34ClN5O |
| Molecular Weight | 432.01 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | 1-[2-(4-chlorophenyl)ethyl]-2-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\CC1CCN(Cc2nc(C)c(C)o2)CC1)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H34ClN5O/c1-4-25-23(26-12-9-19-5-7-21(24)8-6-19)27-15-20-10-13-29(14-11-20)16-22-28-17(2)18(3)30-22/h5-8,20H,4,9-16H2,1-3H3,(H2,25,26,27) |
| InChIKey | JFUNJJREKBSOGY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.01 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|