C24H38IN5O2 — CID 111766082
2-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-1-ethyl-3-[2-(2-methoxyphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111766082) has the molecular formula C24H38IN5O2 and a molecular weight of 555.51 g/mol. Its IUPAC name is 2-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-1-ethyl-3-[2-(2-methoxyphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-1-ethyl-3-[2-(2-methoxyphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111766082 |
| Molecular Formula | C24H38IN5O2 |
| Molecular Weight | 555.51 g/mol |
| Exact Mass | 555.21 |
| IUPAC Name | 2-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-1-ethyl-3-[2-(2-methoxyphenyl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CCN(Cc2nc(C)c(C)o2)CC1)NCCc1ccccc1OC.I |
| InChI | InChI=1S/C24H37N5O2.HI/c1-5-25-24(26-13-10-21-8-6-7-9-22(21)30-4)27-16-20-11-14-29(15-12-20)17-23-28-18(2)19(3)31-23;/h6-9,20H,5,10-17H2,1-4H3,(H2,25,26,27);1H |
| InChIKey | INWQNTJKTOGGPM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 74.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|