C19H25FIN3OS — CID 111763544
1-(2-benzylsulfinylethyl)-3-[2-(4-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111763544) has the molecular formula C19H25FIN3OS and a molecular weight of 489.40 g/mol. Its IUPAC name is 1-(2-benzylsulfinylethyl)-3-[2-(4-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(2-benzylsulfinylethyl)-3-[2-(4-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111763544 |
| Molecular Formula | C19H25FIN3OS |
| Molecular Weight | 489.40 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | 1-(2-benzylsulfinylethyl)-3-[2-(4-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(F)cc1)NCCS(=O)Cc1ccccc1.I |
| InChI | InChI=1S/C19H24FN3OS.HI/c1-21-19(22-12-11-16-7-9-18(20)10-8-16)23-13-14-25(24)15-17-5-3-2-4-6-17;/h2-10H,11-15H2,1H3,(H2,21,22,23);1H |
| InChIKey | QYSYVNSTLTWILQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|