C20H28F2N2O3 — CID 11176505
(E)-N-[(5S,6S)-6-acetamido-7-(3,5-difluorophenyl)-5-hydroxyheptan-3-yl]pent-2-enamide (PubChem CID 11176505) has the molecular formula C20H28F2N2O3 and a molecular weight of 382.45 g/mol. Its IUPAC name is (E)-N-[(5S,6S)-6-acetamido-7-(3,5-difluorophenyl)-5-hydroxyheptan-3-yl]pent-2-enamide.
| Compound Name | (E)-N-[(5S,6S)-6-acetamido-7-(3,5-difluorophenyl)-5-hydroxyheptan-3-yl]pent-2-enamide |
|---|---|
| PubChem CID | 11176505 |
| Molecular Formula | C20H28F2N2O3 |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | (E)-N-[(5S,6S)-6-acetamido-7-(3,5-difluorophenyl)-5-hydroxyheptan-3-yl]pent-2-enamide |
| SMILES | CC/C=C/C(=O)NC(CC)C[C@H](O)[C@H](Cc1cc(F)cc(F)c1)NC(C)=O |
| InChI | InChI=1S/C20H28F2N2O3/c1-4-6-7-20(27)24-17(5-2)12-19(26)18(23-13(3)25)10-14-8-15(21)11-16(22)9-14/h6-9,11,17-19,26H,4-5,10,12H2,1-3H3,(H,23,25)(H,24,27)/b7-6+/t17?,18-,19-/m0/s1 |
| InChIKey | HGQSLRRYCPZFCW-VSFNSEKJSA-N |
| XLogP | 2.62 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|