C21H32F2N2O3 — CID 11153749
N-[(6S,7S)-7-acetamido-8-(3,5-difluorophenyl)-6-hydroxyoctan-4-yl]pentanamide (PubChem CID 11153749) has the molecular formula C21H32F2N2O3 and a molecular weight of 398.49 g/mol. Its IUPAC name is N-[(6S,7S)-7-acetamido-8-(3,5-difluorophenyl)-6-hydroxyoctan-4-yl]pentanamide.
| Compound Name | N-[(6S,7S)-7-acetamido-8-(3,5-difluorophenyl)-6-hydroxyoctan-4-yl]pentanamide |
|---|---|
| PubChem CID | 11153749 |
| Molecular Formula | C21H32F2N2O3 |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | N-[(6S,7S)-7-acetamido-8-(3,5-difluorophenyl)-6-hydroxyoctan-4-yl]pentanamide |
| SMILES | CCCCC(=O)NC(CCC)C[C@H](O)[C@H](Cc1cc(F)cc(F)c1)NC(C)=O |
| InChI | InChI=1S/C21H32F2N2O3/c1-4-6-8-21(28)25-18(7-5-2)13-20(27)19(24-14(3)26)11-15-9-16(22)12-17(23)10-15/h9-10,12,18-20,27H,4-8,11,13H2,1-3H3,(H,24,26)(H,25,28)/t18?,19-,20-/m0/s1 |
| InChIKey | GVBALQKIWFXIMG-YPJRHXLCSA-N |
| XLogP | 3.24 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |