C23H30F2N2O2S — CID 21087139
N-[(2S,3R)-4-(butylamino)-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-4-ethylsulfanylbenzamide (PubChem CID 21087139) has the molecular formula C23H30F2N2O2S and a molecular weight of 436.57 g/mol. Its IUPAC name is N-[(2S,3R)-4-(butylamino)-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-4-ethylsulfanylbenzamide.
| Compound Name | N-[(2S,3R)-4-(butylamino)-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-4-ethylsulfanylbenzamide |
|---|---|
| PubChem CID | 21087139 |
| Molecular Formula | C23H30F2N2O2S |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | N-[(2S,3R)-4-(butylamino)-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-4-ethylsulfanylbenzamide |
| SMILES | CCCCNC[C@@H](O)[C@H](Cc1cc(F)cc(F)c1)NC(=O)c1ccc(SCC)cc1 |
| InChI | InChI=1S/C23H30F2N2O2S/c1-3-5-10-26-15-22(28)21(13-16-11-18(24)14-19(25)12-16)27-23(29)17-6-8-20(9-7-17)30-4-2/h6-9,11-12,14,21-22,26,28H,3-5,10,13,15H2,1-2H3,(H,27,29)/t21-,22+/m0/s1 |
| InChIKey | XEIKZHTWZXFMQT-FCHUYYIVSA-N |
| XLogP | 4.17 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|