C18H34IN5O — CID 111765644
1-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-2-methyl-3-(2-methyl-2-piperidin-1-ylpropyl)guanidine;hydroiodide (PubChem CID 111765644) has the molecular formula C18H34IN5O and a molecular weight of 463.41 g/mol. Its IUPAC name is 1-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-2-methyl-3-(2-methyl-2-piperidin-1-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-2-methyl-3-(2-methyl-2-piperidin-1-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111765644 |
| Molecular Formula | C18H34IN5O |
| Molecular Weight | 463.41 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | 1-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-2-methyl-3-(2-methyl-2-piperidin-1-ylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1c(C)noc1C)NCC(C)(C)N1CCCCC1.I |
| InChI | InChI=1S/C18H33N5O.HI/c1-14-16(15(2)24-22-14)9-10-20-17(19-5)21-13-18(3,4)23-11-7-6-8-12-23;/h6-13H2,1-5H3,(H2,19,20,21);1H |
| InChIKey | WRLZJGITTTZXHW-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|