C16H30IN5O — CID 111764588
1-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111764588) has the molecular formula C16H30IN5O and a molecular weight of 435.35 g/mol. Its IUPAC name is 1-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111764588 |
| Molecular Formula | C16H30IN5O |
| Molecular Weight | 435.35 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 1-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | CCN1CCCC1CN/C(=N\C)NCCc1c(C)noc1C.I |
| InChI | InChI=1S/C16H29N5O.HI/c1-5-21-10-6-7-14(21)11-19-16(17-4)18-9-8-15-12(2)20-22-13(15)3;/h14H,5-11H2,1-4H3,(H2,17,18,19);1H |
| InChIKey | KZWZVINKGFJZGN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|