C13H13F3N2O — CID 11176570
(11aR)-8-(trifluoromethyl)-1,2,3,4,11,11a-hexahydropyrazino[1,2-b]isoquinolin-6-one (PubChem CID 11176570) has the molecular formula C13H13F3N2O and a molecular weight of 270.25 g/mol. Its IUPAC name is (11aR)-8-(trifluoromethyl)-1,2,3,4,11,11a-hexahydropyrazino[1,2-b]isoquinolin-6-one.
| Compound Name | (11aR)-8-(trifluoromethyl)-1,2,3,4,11,11a-hexahydropyrazino[1,2-b]isoquinolin-6-one |
|---|---|
| PubChem CID | 11176570 |
| Molecular Formula | C13H13F3N2O |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | (11aR)-8-(trifluoromethyl)-1,2,3,4,11,11a-hexahydropyrazino[1,2-b]isoquinolin-6-one |
| SMILES | O=C1c2cc(C(F)(F)F)ccc2C[C@@H]2CNCCN12 |
| InChI | InChI=1S/C13H13F3N2O/c14-13(15,16)9-2-1-8-5-10-7-17-3-4-18(10)12(19)11(8)6-9/h1-2,6,10,17H,3-5,7H2/t10-/m1/s1 |
| InChIKey | KGYOIHNXJRJXJD-SNVBAGLBSA-N |
| XLogP | 1.68 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |