C23H34IN5 — CID 111766174
1-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-2-methyl-3-(2-phenylpropyl)guanidine;hydroiodide (PubChem CID 111766174) has the molecular formula C23H34IN5 and a molecular weight of 507.46 g/mol. Its IUPAC name is 1-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-2-methyl-3-(2-phenylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-2-methyl-3-(2-phenylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111766174 |
| Molecular Formula | C23H34IN5 |
| Molecular Weight | 507.46 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | 1-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-2-methyl-3-(2-phenylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccnc(N2CCCCCC2)c1)NCC(C)c1ccccc1.I |
| InChI | InChI=1S/C23H33N5.HI/c1-19(21-10-6-5-7-11-21)17-26-23(24-2)27-18-20-12-13-25-22(16-20)28-14-8-3-4-9-15-28;/h5-7,10-13,16,19H,3-4,8-9,14-15,17-18H2,1-2H3,(H2,24,26,27);1H |
| InChIKey | OGMZWXMRTOIICD-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|