C20H27N5S — CID 111372413
2-methyl-1-(2-phenylsulfanylethyl)-3-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]guanidine (PubChem CID 111372413) has the molecular formula C20H27N5S and a molecular weight of 369.54 g/mol. Its IUPAC name is 2-methyl-1-(2-phenylsulfanylethyl)-3-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]guanidine.
| Compound Name | 2-methyl-1-(2-phenylsulfanylethyl)-3-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 111372413 |
| Molecular Formula | C20H27N5S |
| Molecular Weight | 369.54 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | 2-methyl-1-(2-phenylsulfanylethyl)-3-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]guanidine |
| SMILES | C/N=C(\NCCSc1ccccc1)NCc1ccnc(N2CCCC2)c1 |
| InChI | InChI=1S/C20H27N5S/c1-21-20(23-11-14-26-18-7-3-2-4-8-18)24-16-17-9-10-22-19(15-17)25-12-5-6-13-25/h2-4,7-10,15H,5-6,11-14,16H2,1H3,(H2,21,23,24) |
| InChIKey | FWYIUXWJTUFTCM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.54 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|