C19H34IN3O2S — CID 111768546
1-(2-benzylsulfinylethyl)-3-ethyl-2-[3-(2-methylpropoxy)propyl]guanidine;hydroiodide (PubChem CID 111768546) has the molecular formula C19H34IN3O2S and a molecular weight of 495.47 g/mol. Its IUPAC name is 1-(2-benzylsulfinylethyl)-3-ethyl-2-[3-(2-methylpropoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-(2-benzylsulfinylethyl)-3-ethyl-2-[3-(2-methylpropoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111768546 |
| Molecular Formula | C19H34IN3O2S |
| Molecular Weight | 495.47 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | 1-(2-benzylsulfinylethyl)-3-ethyl-2-[3-(2-methylpropoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCOCC(C)C)NCCS(=O)Cc1ccccc1.I |
| InChI | InChI=1S/C19H33N3O2S.HI/c1-4-20-19(21-11-8-13-24-15-17(2)3)22-12-14-25(23)16-18-9-6-5-7-10-18;/h5-7,9-10,17H,4,8,11-16H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | ADTQGRHHEOQZRN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|