C23H38N4O2 — CID 111769267
1-ethyl-2-[[3-(oxan-4-yloxymethyl)phenyl]methyl]-3-(2-piperidin-1-ylethyl)guanidine (PubChem CID 111769267) has the molecular formula C23H38N4O2 and a molecular weight of 402.58 g/mol. Its IUPAC name is 1-ethyl-2-[[3-(oxan-4-yloxymethyl)phenyl]methyl]-3-(2-piperidin-1-ylethyl)guanidine.
| Compound Name | 1-ethyl-2-[[3-(oxan-4-yloxymethyl)phenyl]methyl]-3-(2-piperidin-1-ylethyl)guanidine |
|---|---|
| PubChem CID | 111769267 |
| Molecular Formula | C23H38N4O2 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.30 |
| IUPAC Name | 1-ethyl-2-[[3-(oxan-4-yloxymethyl)phenyl]methyl]-3-(2-piperidin-1-ylethyl)guanidine |
| SMILES | CCN/C(=N\Cc1cccc(COC2CCOCC2)c1)NCCN1CCCCC1 |
| InChI | InChI=1S/C23H38N4O2/c1-2-24-23(25-11-14-27-12-4-3-5-13-27)26-18-20-7-6-8-21(17-20)19-29-22-9-15-28-16-10-22/h6-8,17,22H,2-5,9-16,18-19H2,1H3,(H2,24,25,26) |
| InChIKey | CXIDMOKZHAQAEZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|