C24H42N4O2 — CID 111764193
1-[2-[di(propan-2-yl)amino]ethyl]-3-ethyl-2-[[3-(oxan-4-yloxymethyl)phenyl]methyl]guanidine (PubChem CID 111764193) has the molecular formula C24H42N4O2 and a molecular weight of 418.63 g/mol. Its IUPAC name is 1-[2-[di(propan-2-yl)amino]ethyl]-3-ethyl-2-[[3-(oxan-4-yloxymethyl)phenyl]methyl]guanidine.
| Compound Name | 1-[2-[di(propan-2-yl)amino]ethyl]-3-ethyl-2-[[3-(oxan-4-yloxymethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111764193 |
| Molecular Formula | C24H42N4O2 |
| Molecular Weight | 418.63 g/mol |
| Exact Mass | 418.33 |
| IUPAC Name | 1-[2-[di(propan-2-yl)amino]ethyl]-3-ethyl-2-[[3-(oxan-4-yloxymethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(COC2CCOCC2)c1)NCCN(C(C)C)C(C)C |
| InChI | InChI=1S/C24H42N4O2/c1-6-25-24(26-12-13-28(19(2)3)20(4)5)27-17-21-8-7-9-22(16-21)18-30-23-10-14-29-15-11-23/h7-9,16,19-20,23H,6,10-15,17-18H2,1-5H3,(H2,25,26,27) |
| InChIKey | QKFYDQMNFWZYRR-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.63 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|