C25H36IN3O3 — CID 109410246
1-ethyl-3-(3-hydroxy-2-phenylpropyl)-2-[[3-(oxan-4-yloxymethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 109410246) has the molecular formula C25H36IN3O3 and a molecular weight of 553.49 g/mol. Its IUPAC name is 1-ethyl-3-(3-hydroxy-2-phenylpropyl)-2-[[3-(oxan-4-yloxymethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(3-hydroxy-2-phenylpropyl)-2-[[3-(oxan-4-yloxymethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109410246 |
| Molecular Formula | C25H36IN3O3 |
| Molecular Weight | 553.49 g/mol |
| Exact Mass | 553.18 |
| IUPAC Name | 1-ethyl-3-(3-hydroxy-2-phenylpropyl)-2-[[3-(oxan-4-yloxymethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(COC2CCOCC2)c1)NCC(CO)c1ccccc1.I |
| InChI | InChI=1S/C25H35N3O3.HI/c1-2-26-25(28-17-23(18-29)22-9-4-3-5-10-22)27-16-20-7-6-8-21(15-20)19-31-24-11-13-30-14-12-24;/h3-10,15,23-24,29H,2,11-14,16-19H2,1H3,(H2,26,27,28);1H |
| InChIKey | YJDYWBMXTRHHAS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|