C14H19N3O — CID 111770347
5-(2-pyrazol-1-ylanilino)pentan-1-ol (PubChem CID 111770347) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 5-(2-pyrazol-1-ylanilino)pentan-1-ol.
| Compound Name | 5-(2-pyrazol-1-ylanilino)pentan-1-ol |
|---|---|
| PubChem CID | 111770347 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 5-(2-pyrazol-1-ylanilino)pentan-1-ol |
| SMILES | OCCCCCNc1ccccc1-n1cccn1 |
| InChI | InChI=1S/C14H19N3O/c18-12-5-1-4-9-15-13-7-2-3-8-14(13)17-11-6-10-16-17/h2-3,6-8,10-11,15,18H,1,4-5,9,12H2 |
| InChIKey | GCXUZMXZCXDDIP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|