C22H29IN4O2 — CID 111772173
1-ethyl-2-[3-(3-oxo-1,4-benzoxazin-4-yl)propyl]-3-(2-phenylethyl)guanidine;hydroiodide (PubChem CID 111772173) has the molecular formula C22H29IN4O2 and a molecular weight of 508.40 g/mol. Its IUPAC name is 1-ethyl-2-[3-(3-oxo-1,4-benzoxazin-4-yl)propyl]-3-(2-phenylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[3-(3-oxo-1,4-benzoxazin-4-yl)propyl]-3-(2-phenylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111772173 |
| Molecular Formula | C22H29IN4O2 |
| Molecular Weight | 508.40 g/mol |
| Exact Mass | 508.13 |
| IUPAC Name | 1-ethyl-2-[3-(3-oxo-1,4-benzoxazin-4-yl)propyl]-3-(2-phenylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCN1C(=O)COc2ccccc21)NCCc1ccccc1.I |
| InChI | InChI=1S/C22H28N4O2.HI/c1-2-23-22(25-15-13-18-9-4-3-5-10-18)24-14-8-16-26-19-11-6-7-12-20(19)28-17-21(26)27;/h3-7,9-12H,2,8,13-17H2,1H3,(H2,23,24,25);1H |
| InChIKey | FHPHCJARSNDCAZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|