C20H34N4O — CID 111773160
3-[2-[[ethylamino-(heptan-2-ylamino)methylidene]amino]ethyl]-N-methylbenzamide (PubChem CID 111773160) has the molecular formula C20H34N4O and a molecular weight of 346.52 g/mol. Its IUPAC name is 3-[2-[[ethylamino-(heptan-2-ylamino)methylidene]amino]ethyl]-N-methylbenzamide.
| Compound Name | 3-[2-[[ethylamino-(heptan-2-ylamino)methylidene]amino]ethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 111773160 |
| Molecular Formula | C20H34N4O |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | 3-[2-[[ethylamino-(heptan-2-ylamino)methylidene]amino]ethyl]-N-methylbenzamide |
| SMILES | CCCCCC(C)N/C(=N/CCc1cccc(C(=O)NC)c1)NCC |
| InChI | InChI=1S/C20H34N4O/c1-5-7-8-10-16(3)24-20(22-6-2)23-14-13-17-11-9-12-18(15-17)19(25)21-4/h9,11-12,15-16H,5-8,10,13-14H2,1-4H3,(H,21,25)(H2,22,23,24) |
| InChIKey | VUQJSQCSZHUXKG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|