C21H27IN4O3 — CID 111773505
1-[(2-methoxyphenyl)methyl]-2-methyl-3-[3-(3-oxo-1,4-benzoxazin-4-yl)propyl]guanidine;hydroiodide (PubChem CID 111773505) has the molecular formula C21H27IN4O3 and a molecular weight of 510.38 g/mol. Its IUPAC name is 1-[(2-methoxyphenyl)methyl]-2-methyl-3-[3-(3-oxo-1,4-benzoxazin-4-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[(2-methoxyphenyl)methyl]-2-methyl-3-[3-(3-oxo-1,4-benzoxazin-4-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111773505 |
| Molecular Formula | C21H27IN4O3 |
| Molecular Weight | 510.38 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | 1-[(2-methoxyphenyl)methyl]-2-methyl-3-[3-(3-oxo-1,4-benzoxazin-4-yl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCN1C(=O)COc2ccccc21)NCc1ccccc1OC.I |
| InChI | InChI=1S/C21H26N4O3.HI/c1-22-21(24-14-16-8-3-5-10-18(16)27-2)23-12-7-13-25-17-9-4-6-11-19(17)28-15-20(25)26;/h3-6,8-11H,7,12-15H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | MQKPMQJZCQPALM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|