C19H25IN4O2S — CID 111775461
2-methyl-1-[3-(3-oxo-1,4-benzoxazin-4-yl)propyl]-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111775461) has the molecular formula C19H25IN4O2S and a molecular weight of 500.41 g/mol. Its IUPAC name is 2-methyl-1-[3-(3-oxo-1,4-benzoxazin-4-yl)propyl]-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[3-(3-oxo-1,4-benzoxazin-4-yl)propyl]-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111775461 |
| Molecular Formula | C19H25IN4O2S |
| Molecular Weight | 500.41 g/mol |
| Exact Mass | 500.07 |
| IUPAC Name | 2-methyl-1-[3-(3-oxo-1,4-benzoxazin-4-yl)propyl]-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCN1C(=O)COc2ccccc21)NCCc1cccs1.I |
| InChI | InChI=1S/C19H24N4O2S.HI/c1-20-19(22-11-9-15-6-4-13-26-15)21-10-5-12-23-16-7-2-3-8-17(16)25-14-18(23)24;/h2-4,6-8,13H,5,9-12,14H2,1H3,(H2,20,21,22);1H |
| InChIKey | KSVUTOQWCPLQBZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|