C25H33FN4O2 — CID 111774762
1-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-[(2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)methyl]-2-methylguanidine (PubChem CID 111774762) has the molecular formula C25H33FN4O2 and a molecular weight of 440.56 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-[(2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)methyl]-2-methylguanidine.
| Compound Name | 1-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-[(2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111774762 |
| Molecular Formula | C25H33FN4O2 |
| Molecular Weight | 440.56 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | 1-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-[(2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)methyl]-2-methylguanidine |
| SMILES | C/N=C(/NCc1c(O)ccc2c1CCCC2)NCC(c1ccc(F)cc1)N1CCOCC1 |
| InChI | InChI=1S/C25H33FN4O2/c1-27-25(28-16-22-21-5-3-2-4-18(21)8-11-24(22)31)29-17-23(30-12-14-32-15-13-30)19-6-9-20(26)10-7-19/h6-11,23,31H,2-5,12-17H2,1H3,(H2,27,28,29) |
| InChIKey | MOHRIOVDCMKKJO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.56 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|