C17H32IN5OS — CID 111774809
2-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-1-ethyl-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine;hydroiodide (PubChem CID 111774809) has the molecular formula C17H32IN5OS and a molecular weight of 481.45 g/mol. Its IUPAC name is 2-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-1-ethyl-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine;hydroiodide.
| Compound Name | 2-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-1-ethyl-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111774809 |
| Molecular Formula | C17H32IN5OS |
| Molecular Weight | 481.45 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | 2-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-1-ethyl-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1sc(C)nc1C)NCC(C)(C)N1CCOCC1.I |
| InChI | InChI=1S/C17H31N5OS.HI/c1-6-18-16(19-11-15-13(2)21-14(3)24-15)20-12-17(4,5)22-7-9-23-10-8-22;/h6-12H2,1-5H3,(H2,18,19,20);1H |
| InChIKey | VFKZGVXVQKRCSR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|