C18H26ClN5S — CID 111775918
1-[2-(4-chlorophenyl)sulfanylethyl]-2-methyl-3-[[1-(2-methylpropyl)imidazol-2-yl]methyl]guanidine (PubChem CID 111775918) has the molecular formula C18H26ClN5S and a molecular weight of 379.96 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)sulfanylethyl]-2-methyl-3-[[1-(2-methylpropyl)imidazol-2-yl]methyl]guanidine.
| Compound Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-2-methyl-3-[[1-(2-methylpropyl)imidazol-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111775918 |
| Molecular Formula | C18H26ClN5S |
| Molecular Weight | 379.96 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-2-methyl-3-[[1-(2-methylpropyl)imidazol-2-yl]methyl]guanidine |
| SMILES | C/N=C(/NCCSc1ccc(Cl)cc1)NCc1nccn1CC(C)C |
| InChI | InChI=1S/C18H26ClN5S/c1-14(2)13-24-10-8-21-17(24)12-23-18(20-3)22-9-11-25-16-6-4-15(19)5-7-16/h4-8,10,14H,9,11-13H2,1-3H3,(H2,20,22,23) |
| InChIKey | TYUOCTFCEMGBSS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.96 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|