C18H22N2O4 — CID 111778073
4-(3-ethoxy-4-nitroanilino)-4-phenylbutan-1-ol (PubChem CID 111778073) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 4-(3-ethoxy-4-nitroanilino)-4-phenylbutan-1-ol.
| Compound Name | 4-(3-ethoxy-4-nitroanilino)-4-phenylbutan-1-ol |
|---|---|
| PubChem CID | 111778073 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 4-(3-ethoxy-4-nitroanilino)-4-phenylbutan-1-ol |
| SMILES | CCOc1cc(NC(CCCO)c2ccccc2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H22N2O4/c1-2-24-18-13-15(10-11-17(18)20(22)23)19-16(9-6-12-21)14-7-4-3-5-8-14/h3-5,7-8,10-11,13,16,19,21H,2,6,9,12H2,1H3 |
| InChIKey | XLAOZPHRVOBYSK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|