C13H21N3O3 — CID 65193051
2-N-(3-ethoxy-4-nitrophenyl)pentane-1,2-diamine (PubChem CID 65193051) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-N-(3-ethoxy-4-nitrophenyl)pentane-1,2-diamine.
| Compound Name | 2-N-(3-ethoxy-4-nitrophenyl)pentane-1,2-diamine |
|---|---|
| PubChem CID | 65193051 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 2-N-(3-ethoxy-4-nitrophenyl)pentane-1,2-diamine |
| SMILES | CCCC(CN)Nc1ccc([N+](=O)[O-])c(OCC)c1 |
| InChI | InChI=1S/C13H21N3O3/c1-3-5-11(9-14)15-10-6-7-12(16(17)18)13(8-10)19-4-2/h6-8,11,15H,3-5,9,14H2,1-2H3 |
| InChIKey | FYGPCSHWZUTHAX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|