C15H21NO2 — CID 111778112
3-[(5,6-dimethyl-1-benzofuran-2-yl)methylamino]butan-1-ol (PubChem CID 111778112) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 3-[(5,6-dimethyl-1-benzofuran-2-yl)methylamino]butan-1-ol.
| Compound Name | 3-[(5,6-dimethyl-1-benzofuran-2-yl)methylamino]butan-1-ol |
|---|---|
| PubChem CID | 111778112 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 3-[(5,6-dimethyl-1-benzofuran-2-yl)methylamino]butan-1-ol |
| SMILES | Cc1cc2cc(CNC(C)CCO)oc2cc1C |
| InChI | InChI=1S/C15H21NO2/c1-10-6-13-8-14(9-16-12(3)4-5-17)18-15(13)7-11(10)2/h6-8,12,16-17H,4-5,9H2,1-3H3 |
| InChIKey | HZWVZWLTDWCIHU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |