C14H18FNO2 — CID 111778224
2-(3,6-dihydro-2H-pyran-5-ylmethylamino)-1-(2-fluorophenyl)ethanol (PubChem CID 111778224) has the molecular formula C14H18FNO2 and a molecular weight of 251.30 g/mol. Its IUPAC name is 2-(3,6-dihydro-2H-pyran-5-ylmethylamino)-1-(2-fluorophenyl)ethanol.
| Compound Name | 2-(3,6-dihydro-2H-pyran-5-ylmethylamino)-1-(2-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 111778224 |
| Molecular Formula | C14H18FNO2 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 2-(3,6-dihydro-2H-pyran-5-ylmethylamino)-1-(2-fluorophenyl)ethanol |
| SMILES | OC(CNCC1=CCCOC1)c1ccccc1F |
| InChI | InChI=1S/C14H18FNO2/c15-13-6-2-1-5-12(13)14(17)9-16-8-11-4-3-7-18-10-11/h1-2,4-6,14,16-17H,3,7-10H2 |
| InChIKey | RCJVZECADJEFKH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|