C10H24N4O3S — CID 111779047
1-[2-(methanesulfonamido)-2-methylpropyl]-3-(2-methoxyethyl)-2-methylguanidine (PubChem CID 111779047) has the molecular formula C10H24N4O3S and a molecular weight of 280.39 g/mol. Its IUPAC name is 1-[2-(methanesulfonamido)-2-methylpropyl]-3-(2-methoxyethyl)-2-methylguanidine.
| Compound Name | 1-[2-(methanesulfonamido)-2-methylpropyl]-3-(2-methoxyethyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111779047 |
| Molecular Formula | C10H24N4O3S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 1-[2-(methanesulfonamido)-2-methylpropyl]-3-(2-methoxyethyl)-2-methylguanidine |
| SMILES | C/N=C(\NCCOC)NCC(C)(C)NS(C)(=O)=O |
| InChI | InChI=1S/C10H24N4O3S/c1-10(2,14-18(5,15)16)8-13-9(11-3)12-6-7-17-4/h14H,6-8H2,1-5H3,(H2,11,12,13) |
| InChIKey | NEIMCGIEUPEPRV-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|