C12H26N4O2S — CID 111779531
1-cyclopentyl-3-[2-(methanesulfonamido)-2-methylpropyl]-2-methylguanidine (PubChem CID 111779531) has the molecular formula C12H26N4O2S and a molecular weight of 290.43 g/mol. Its IUPAC name is 1-cyclopentyl-3-[2-(methanesulfonamido)-2-methylpropyl]-2-methylguanidine.
| Compound Name | 1-cyclopentyl-3-[2-(methanesulfonamido)-2-methylpropyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111779531 |
| Molecular Formula | C12H26N4O2S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 1-cyclopentyl-3-[2-(methanesulfonamido)-2-methylpropyl]-2-methylguanidine |
| SMILES | C/N=C(\NCC(C)(C)NS(C)(=O)=O)NC1CCCC1 |
| InChI | InChI=1S/C12H26N4O2S/c1-12(2,16-19(4,17)18)9-14-11(13-3)15-10-7-5-6-8-10/h10,16H,5-9H2,1-4H3,(H2,13,14,15) |
| InChIKey | MGJACPPCDZHQCO-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|