C15H34IN5O2S — CID 111784313
1-[2-(methanesulfonamido)-2-methylpropyl]-2-methyl-3-(1-propan-2-ylpiperidin-4-yl)guanidine;hydroiodide (PubChem CID 111784313) has the molecular formula C15H34IN5O2S and a molecular weight of 475.44 g/mol. Its IUPAC name is 1-[2-(methanesulfonamido)-2-methylpropyl]-2-methyl-3-(1-propan-2-ylpiperidin-4-yl)guanidine;hydroiodide.
| Compound Name | 1-[2-(methanesulfonamido)-2-methylpropyl]-2-methyl-3-(1-propan-2-ylpiperidin-4-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111784313 |
| Molecular Formula | C15H34IN5O2S |
| Molecular Weight | 475.44 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | 1-[2-(methanesulfonamido)-2-methylpropyl]-2-methyl-3-(1-propan-2-ylpiperidin-4-yl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCC(C)(C)NS(C)(=O)=O)NC1CCN(C(C)C)CC1.I |
| InChI | InChI=1S/C15H33N5O2S.HI/c1-12(2)20-9-7-13(8-10-20)18-14(16-5)17-11-15(3,4)19-23(6,21)22;/h12-13,19H,7-11H2,1-6H3,(H2,16,17,18);1H |
| InChIKey | DJCBTRKGJMCHGU-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.44 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|