C11H19BrN2O2 — CID 111781062
2-[2-bromoprop-2-enyl(methyl)amino]-1-(4-hydroxypiperidin-1-yl)ethanone (PubChem CID 111781062) has the molecular formula C11H19BrN2O2 and a molecular weight of 291.19 g/mol. Its IUPAC name is 2-[2-bromoprop-2-enyl(methyl)amino]-1-(4-hydroxypiperidin-1-yl)ethanone.
| Compound Name | 2-[2-bromoprop-2-enyl(methyl)amino]-1-(4-hydroxypiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 111781062 |
| Molecular Formula | C11H19BrN2O2 |
| Molecular Weight | 291.19 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 2-[2-bromoprop-2-enyl(methyl)amino]-1-(4-hydroxypiperidin-1-yl)ethanone |
| SMILES | C=C(Br)CN(C)CC(=O)N1CCC(O)CC1 |
| InChI | InChI=1S/C11H19BrN2O2/c1-9(12)7-13(2)8-11(16)14-5-3-10(15)4-6-14/h10,15H,1,3-8H2,2H3 |
| InChIKey | CYGCMKSUNDWGAN-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.19 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |