C12H28N2O2 — CID 177000200
ethane;4-hydroxy-N,N-dimethylpiperidine-1-carboxamide (PubChem CID 177000200) has the molecular formula C12H28N2O2 and a molecular weight of 232.37 g/mol. Its IUPAC name is ethane;4-hydroxy-N,N-dimethylpiperidine-1-carboxamide.
| Compound Name | ethane;4-hydroxy-N,N-dimethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 177000200 |
| Molecular Formula | C12H28N2O2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | ethane;4-hydroxy-N,N-dimethylpiperidine-1-carboxamide |
| SMILES | CC.CC.CN(C)C(=O)N1CCC(O)CC1 |
| InChI | InChI=1S/C8H16N2O2.2C2H6/c1-9(2)8(12)10-5-3-7(11)4-6-10;2*1-2/h7,11H,3-6H2,1-2H3;2*1-2H3 |
| InChIKey | RPFPQXVRQYNSFC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |