C13H25N3O2 — CID 60779224
4-N-tert-butyl-1-N,1-N-dimethylpiperidine-1,4-dicarboxamide (PubChem CID 60779224) has the molecular formula C13H25N3O2 and a molecular weight of 255.36 g/mol. Its IUPAC name is 4-N-tert-butyl-1-N,1-N-dimethylpiperidine-1,4-dicarboxamide.
| Compound Name | 4-N-tert-butyl-1-N,1-N-dimethylpiperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 60779224 |
| Molecular Formula | C13H25N3O2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | 4-N-tert-butyl-1-N,1-N-dimethylpiperidine-1,4-dicarboxamide |
| SMILES | CN(C)C(=O)N1CCC(C(=O)NC(C)(C)C)CC1 |
| InChI | InChI=1S/C13H25N3O2/c1-13(2,3)14-11(17)10-6-8-16(9-7-10)12(18)15(4)5/h10H,6-9H2,1-5H3,(H,14,17) |
| InChIKey | IFMJTWNSWILBDX-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |