C18H28N4 — CID 111781702
1-ethyl-3-[2-(7-methyl-1H-indol-3-yl)ethyl]-2-(2-methylpropyl)guanidine (PubChem CID 111781702) has the molecular formula C18H28N4 and a molecular weight of 300.45 g/mol. Its IUPAC name is 1-ethyl-3-[2-(7-methyl-1H-indol-3-yl)ethyl]-2-(2-methylpropyl)guanidine.
| Compound Name | 1-ethyl-3-[2-(7-methyl-1H-indol-3-yl)ethyl]-2-(2-methylpropyl)guanidine |
|---|---|
| PubChem CID | 111781702 |
| Molecular Formula | C18H28N4 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | 1-ethyl-3-[2-(7-methyl-1H-indol-3-yl)ethyl]-2-(2-methylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)C)NCCc1c[nH]c2c(C)cccc12 |
| InChI | InChI=1S/C18H28N4/c1-5-19-18(22-11-13(2)3)20-10-9-15-12-21-17-14(4)7-6-8-16(15)17/h6-8,12-13,21H,5,9-11H2,1-4H3,(H2,19,20,22) |
| InChIKey | KZVVDNDCRRWXRY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 52.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|