C19H29ClIN5 — CID 111783530
1-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111783530) has the molecular formula C19H29ClIN5 and a molecular weight of 489.83 g/mol. Its IUPAC name is 1-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111783530 |
| Molecular Formula | C19H29ClIN5 |
| Molecular Weight | 489.83 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | 1-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | CCN1CCCC1CN/C(=N\C)NCCc1c[nH]c2ccc(Cl)cc12.I |
| InChI | InChI=1S/C19H28ClN5.HI/c1-3-25-10-4-5-16(25)13-24-19(21-2)22-9-8-14-12-23-18-7-6-15(20)11-17(14)18;/h6-7,11-12,16,23H,3-5,8-10,13H2,1-2H3,(H2,21,22,24);1H |
| InChIKey | ZSGUDJOBQWTVOB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.83 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|