C24H33NO5S — CID 11178371
1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[[(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methylsulfanyl]pyrrolidine-2,5-dione (PubChem CID 11178371) has the molecular formula C24H33NO5S and a molecular weight of 447.60 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[[(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methylsulfanyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[[(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methylsulfanyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 11178371 |
| Molecular Formula | C24H33NO5S |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[[(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methylsulfanyl]pyrrolidine-2,5-dione |
| SMILES | COc1ccc(CCN2C(=O)CC(SC[C@]34CC[C@H](C[C@H]3O)C4(C)C)C2=O)cc1OC |
| InChI | InChI=1S/C24H33NO5S/c1-23(2)16-7-9-24(23,20(26)12-16)14-31-19-13-21(27)25(22(19)28)10-8-15-5-6-17(29-3)18(11-15)30-4/h5-6,11,16,19-20,26H,7-10,12-14H2,1-4H3/t16-,19?,20-,24-/m1/s1 |
| InChIKey | WQKPDWCMWKGWOK-OJWINJRWSA-N |
| XLogP | 3.29 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|