C15H31N3O4 — CID 111787321
tert-butyl 2-[[ethylamino-[3-(2-methoxyethoxy)propylamino]methylidene]amino]acetate (PubChem CID 111787321) has the molecular formula C15H31N3O4 and a molecular weight of 317.43 g/mol. Its IUPAC name is tert-butyl 2-[[ethylamino-[3-(2-methoxyethoxy)propylamino]methylidene]amino]acetate.
| Compound Name | tert-butyl 2-[[ethylamino-[3-(2-methoxyethoxy)propylamino]methylidene]amino]acetate |
|---|---|
| PubChem CID | 111787321 |
| Molecular Formula | C15H31N3O4 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.23 |
| IUPAC Name | tert-butyl 2-[[ethylamino-[3-(2-methoxyethoxy)propylamino]methylidene]amino]acetate |
| SMILES | CCN/C(=N\CC(=O)OC(C)(C)C)NCCCOCCOC |
| InChI | InChI=1S/C15H31N3O4/c1-6-16-14(17-8-7-9-21-11-10-20-5)18-12-13(19)22-15(2,3)4/h6-12H2,1-5H3,(H2,16,17,18) |
| InChIKey | TZXWNEUWZARUNQ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|