C19H32ClIN4S — CID 111789499
2-[[1-[(2-chlorophenyl)methyl]piperidin-4-yl]methyl]-1-ethyl-3-(2-methylsulfanylethyl)guanidine;hydroiodide (PubChem CID 111789499) has the molecular formula C19H32ClIN4S and a molecular weight of 510.92 g/mol. Its IUPAC name is 2-[[1-[(2-chlorophenyl)methyl]piperidin-4-yl]methyl]-1-ethyl-3-(2-methylsulfanylethyl)guanidine;hydroiodide.
| Compound Name | 2-[[1-[(2-chlorophenyl)methyl]piperidin-4-yl]methyl]-1-ethyl-3-(2-methylsulfanylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111789499 |
| Molecular Formula | C19H32ClIN4S |
| Molecular Weight | 510.92 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | 2-[[1-[(2-chlorophenyl)methyl]piperidin-4-yl]methyl]-1-ethyl-3-(2-methylsulfanylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CCN(Cc2ccccc2Cl)CC1)NCCSC.I |
| InChI | InChI=1S/C19H31ClN4S.HI/c1-3-21-19(22-10-13-25-2)23-14-16-8-11-24(12-9-16)15-17-6-4-5-7-18(17)20;/h4-7,16H,3,8-15H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | ZFUSAPZUWZZJQP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.92 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|