C17H29IN4O — CID 111789750
1-ethyl-3-[(2-hydroxy-1-methylcyclohexyl)methyl]-2-(pyridin-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111789750) has the molecular formula C17H29IN4O and a molecular weight of 432.35 g/mol. Its IUPAC name is 1-ethyl-3-[(2-hydroxy-1-methylcyclohexyl)methyl]-2-(pyridin-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[(2-hydroxy-1-methylcyclohexyl)methyl]-2-(pyridin-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111789750 |
| Molecular Formula | C17H29IN4O |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 1-ethyl-3-[(2-hydroxy-1-methylcyclohexyl)methyl]-2-(pyridin-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccn1)NCC1(C)CCCCC1O.I |
| InChI | InChI=1S/C17H28N4O.HI/c1-3-18-16(20-12-14-8-5-7-11-19-14)21-13-17(2)10-6-4-9-15(17)22;/h5,7-8,11,15,22H,3-4,6,9-10,12-13H2,1-2H3,(H2,18,20,21);1H |
| InChIKey | LFQIHCLSGXDUDG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|