C20H38IN5O — CID 109406435
2-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1-ethyl-3-[(2-hydroxy-1-methylcyclohexyl)methyl]guanidine;hydroiodide (PubChem CID 109406435) has the molecular formula C20H38IN5O and a molecular weight of 491.46 g/mol. Its IUPAC name is 2-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1-ethyl-3-[(2-hydroxy-1-methylcyclohexyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1-ethyl-3-[(2-hydroxy-1-methylcyclohexyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109406435 |
| Molecular Formula | C20H38IN5O |
| Molecular Weight | 491.46 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | 2-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1-ethyl-3-[(2-hydroxy-1-methylcyclohexyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1c(CC)nn(C)c1CC)NCC1(C)CCCCC1O.I |
| InChI | InChI=1S/C20H37N5O.HI/c1-6-16-15(17(7-2)25(5)24-16)13-22-19(21-8-3)23-14-20(4)12-10-9-11-18(20)26;/h18,26H,6-14H2,1-5H3,(H2,21,22,23);1H |
| InChIKey | XOTMPCXHISYYTM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|