C18H37N3O — CID 111789890
1-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]-3-(4-methylcyclohexyl)guanidine (PubChem CID 111789890) has the molecular formula C18H37N3O and a molecular weight of 311.51 g/mol. Its IUPAC name is 1-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]-3-(4-methylcyclohexyl)guanidine.
| Compound Name | 1-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]-3-(4-methylcyclohexyl)guanidine |
|---|---|
| PubChem CID | 111789890 |
| Molecular Formula | C18H37N3O |
| Molecular Weight | 311.51 g/mol |
| Exact Mass | 311.29 |
| IUPAC Name | 1-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]-3-(4-methylcyclohexyl)guanidine |
| SMILES | CCN/C(=N\CC(CCO)CC(C)C)NC1CCC(C)CC1 |
| InChI | InChI=1S/C18H37N3O/c1-5-19-18(21-17-8-6-15(4)7-9-17)20-13-16(10-11-22)12-14(2)3/h14-17,22H,5-13H2,1-4H3,(H2,19,20,21) |
| InChIKey | IGVZADQUTKPKBW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.51 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|